BDBM120857 US8716478, D243::US9499570, D243
SMILES CC(C)OCCOc1nc(Oc2ccc3B(O)OCc3c2)c(cc1C#N)C#N
InChI Key InChIKey=VUKLRTNDLAMXGZ-UHFFFAOYSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 120857
TargetcAMP-specific 3',5'-cyclic phosphodiesterase 4B(Homo sapiens (Human))
Anacor Pharmaceuticals
US Patent
Anacor Pharmaceuticals
US Patent
Affinity DataIC50: 6.5nMpH: 7.5Assay Description:Inhibition of the human PDE4 enzyme, using semi-purified enzyme from human U937 cells. The PDE4 enzyme was partially purified from human U937 myeloid...More data for this Ligand-Target Pair
TargetcAMP-specific 3',5'-cyclic phosphodiesterase 4A(Homo sapiens (Human))
Anacor Pharmaceuticals
US Patent
Anacor Pharmaceuticals
US Patent
Affinity DataIC50: 6.5nMpH: 7.5 T: 2°CAssay Description:Inhibition of the human PDE4 enzyme, using semi-purified enzyme from human U937 cells. The PDE4 enzyme was partially purified from human U937 myeloid...More data for this Ligand-Target Pair