BDBM18847 (2Z)-3-[(4-hexylphenyl)carbamoyl]prop-2-enoic acid::Substituted Acrylamide, 7b
SMILES CCCCCCc1ccc(NC(=O)\C=C/C(O)=O)cc1
InChI Key InChIKey=OOWYMHDWBQTCOX-QXMHVHEDSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 18847
Affinity DataIC50: 1.79E+4nMAssay Description:IC50 is the concentration of each compound required to inhibit 50% of the binding between the TR LBD and the SRC2-2 peptide using fluorescence polari...More data for this Ligand-Target Pair
Affinity DataIC50: 1.75E+4nMAssay Description:IC50 is the concentration of each compound required to inhibit 50% of the binding between the TR LBD and the SRC2-2 peptide using fluorescence polari...More data for this Ligand-Target Pair