BDBM258687 US9499482, 86
SMILES CNCCOc1ccc(cc1C)N1CC[C@H](Oc2ccc(cc2)C2CC2)C1=O
InChI Key InChIKey=WVOIRNCJWRMPLL-QFIPXVFZSA-N
Data 1 KI
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 1 hit for monomerid = 258687
TargetMelanin-concentrating hormone receptor 1 [E4Q,A5T](Homo sapiens (Human))
Bristol-Myers Squibb
US Patent
Bristol-Myers Squibb
US Patent
Affinity DataKi: 1.10nMpH: 7.4Assay Description:An in vitro binding assay was used to determine the compound Ki value or ability to antagonize binding of a peptide agonist to the human melanin conc...More data for this Ligand-Target Pair