BDBM273070 (R)-N-benzyl-1-(6-methyl-7-oxo-5-phenyl-6,7-dihydro[1,3]thiazolo[5,4-d]pyrimidin-2-yl)pyrrolidine-2-carboxamide::BDBM273093::BDBM273119::BDBM273143::BDBM273144::US10065972, Example 178
SMILES Cn1c(nc2sc(nc2c1=O)N1CCC[C@@H]1C(=O)NCc1ccccc1)-c1ccccc1
InChI Key InChIKey=LYGQOCVESZDBMV-GOSISDBHSA-N
Data 5 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 5 hits for monomerid = 273070
TargetKynurenine/alpha-aminoadipate aminotransferase, mitochondrial(Homo sapiens (Human))
Mitsubishi Tanabe Pharma
US Patent
Mitsubishi Tanabe Pharma
US Patent
Affinity DataIC50: 12nMpH: 8.0Assay Description:The inhibitory action of the test compound on human recombinant KAT-II was determined by the following method.To a reaction mixture (45 μL) cont...More data for this Ligand-Target Pair
TargetKynurenine/alpha-aminoadipate aminotransferase, mitochondrial(Homo sapiens (Human))
Mitsubishi Tanabe Pharma
US Patent
Mitsubishi Tanabe Pharma
US Patent
Affinity DataIC50: 5.40nMpH: 8.0Assay Description:The inhibitory action of the test compound on human recombinant KAT-II was determined by the following method.To a reaction mixture (45 μL) cont...More data for this Ligand-Target Pair
TargetKynurenine/alpha-aminoadipate aminotransferase, mitochondrial(Homo sapiens (Human))
Mitsubishi Tanabe Pharma
US Patent
Mitsubishi Tanabe Pharma
US Patent
Affinity DataIC50: 11nMpH: 8.0Assay Description:The inhibitory action of the test compound on human recombinant KAT-II was determined by the following method.To a reaction mixture (45 μL) cont...More data for this Ligand-Target Pair
TargetKynurenine/alpha-aminoadipate aminotransferase, mitochondrial(Homo sapiens (Human))
Mitsubishi Tanabe Pharma
US Patent
Mitsubishi Tanabe Pharma
US Patent
Affinity DataIC50: 16nMpH: 8.0Assay Description:The inhibitory action of the test compound on human recombinant KAT-II was determined by the following method.To a reaction mixture (45 μL) cont...More data for this Ligand-Target Pair
TargetKynurenine/alpha-aminoadipate aminotransferase, mitochondrial(Homo sapiens (Human))
Mitsubishi Tanabe Pharma
US Patent
Mitsubishi Tanabe Pharma
US Patent
Affinity DataIC50: 16nMpH: 8.0Assay Description:The inhibitory action of the test compound on human recombinant KAT-II was determined by the following method.To a reaction mixture (45 μL) cont...More data for this Ligand-Target Pair