BDBM288885 US10092563, Compound 20
SMILES C[C@H](Nc1nc(N)nc(N)c1Cl)c1nc2c(F)ccc(Cl)c2c(=O)n1N1CCNCC1
InChI Key InChIKey=OCCLWIXLRYWDHI-QMMMGPOBSA-N
Data 3 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 3 hits for monomerid = 288885
TargetPhosphatidylinositol 3-kinase regulatory subunit beta(Homo sapiens (Human))
Gilead Sciences
US Patent
Gilead Sciences
US Patent
Affinity DataIC50: 4.00E+4nMpH: 7.4Assay Description:TR-FRET monitored the formation of 3,4,5-inositol triphosphate molecule that competed with fluorescently labeled PIPS for binding to the GRP-1 plecks...More data for this Ligand-Target Pair
TargetPhosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform(Homo sapiens (Human))
Gilead Sciences
US Patent
Gilead Sciences
US Patent
Affinity DataIC50: >1.00E+7nMpH: 7.4Assay Description:TR-FRET monitored the formation of 3,4,5-inositol triphosphate molecule that competed with fluorescently labeled PIPS for binding to the GRP-1 plecks...More data for this Ligand-Target Pair
TargetPhosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit delta isoform(Homo sapiens (Human))
Gilead Sciences
US Patent
Gilead Sciences
US Patent
Affinity DataIC50: 2.00E+4nMpH: 7.4Assay Description:TR-FRET monitored the formation of 3,4,5-inositol triphosphate molecule that competed with fluorescently labeled PIPS for binding to the GRP-1 plecks...More data for this Ligand-Target Pair