BDBM322530 5-[3-[5-(2-chlorophenyl)-1H-imidazol-2-yl]chroman-6-yl]oxy-3,4-dihydro-1H-1,8-naphthyridin-2-one::US10183939, Example 8::USRE49361, Example 8
SMILES Clc1ccccc1-c1cnc([nH]1)C1COc2ccc(Oc3ccnc4NC(=O)CCc34)cc2C1
InChI Key
Data 4 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 4 hits for monomerid = 322530
TargetSerine/threonine-protein kinase B-raf [416-766,V600E](Homo sapiens (Human))
Redx Pharma
US Patent
Redx Pharma
US Patent
Affinity DataIC50: <4nMAssay Description:To determine whether compounds bind to RAF kinases, they are tested in a competition binding assay. The Invitrogen LanthaScreen Eu binding assay invo...More data for this Ligand-Target Pair
TargetRAF proto-oncogene serine/threonine-protein kinase(Homo sapiens (Human))
Jazz Pharmaceuticals Ireland
US Patent
Jazz Pharmaceuticals Ireland
US Patent
Affinity DataIC50: <4nMAssay Description:B-RAF, RAFV600E, and C-RAF: Compounds at a concentration of 3 mM are serially diluted (e.g. 10 μl, 90 μl of 100% dimethyl sulfoxide (DMSO))...More data for this Ligand-Target Pair
TargetSerine/threonine-protein kinase B-raf [V600E](Homo sapiens (Human))
Jazz Pharmaceuticals Ireland
US Patent
Jazz Pharmaceuticals Ireland
US Patent
Affinity DataIC50: <4nMAssay Description:B-RAF, RAFV600E, and C-RAF: Compounds at a concentration of 3 mM are serially diluted (e.g. 10 μl, 90 μl of 100% dimethyl sulfoxide (DMSO))...More data for this Ligand-Target Pair
TargetRAF proto-oncogene serine/threonine-protein kinase [Y340D,Y341D](Homo sapiens (Human))
Redx Pharma
US Patent
Redx Pharma
US Patent