BindingDB logo
myBDB logout

37 SMILES Strings for α-Carbonic anhydrase (αCA)

Compound NameSMILES String
BDBM50344898 O=[Ru-](=O)(=O)=O
BDBM26984 [C-]#N
BDBM26985 [N-]=[N+]=[N-]
BDBM26986 OC([O-])=O
BDBM26987 [O-]C([O-])=O
BDBM26988 [O-][N+]([O-])=O
BDBM26989 [O-]N=O
BDBM26990 [SH-]
BDBM26991 OS([O-])=O
BDBM26992 [O-]S([O-])(=O)=O
BDBM26993 F[B-](F)(F)F
BDBM26994 NS(O)(=O)=O
BDBM26995 NS(N)(=O)=O
BDBM26996 OB(O)c1ccccc1
BDBM26997 O[As](O)(=O)c1ccccc1
BDBM36131 [O-][Cl](=O)(=O)=O
BDBM50278314 [O-][Os]([O-])(=O)(=O)=O
BDBM50010231 CCN(CC)C([S-])=S
BDBM50130701 [O-][Se]([O-])(=O)=O
BDBM50278312 [O-][Sn]([O-])=O
BDBM50278313 [O-][Te]([O-])(=O)=O
BDBM50278315 [O-]S(=O)(=O)OS([O-])(=O)=O
BDBM50278316 [O-]P([O-])(=O)OP([O-])([O-])=O
BDBM50278318 [O-][Re](=O)(=O)=O
BDBM50278319 [O-]S(=O)(=O)OOS([O-])(=O)=O
BDBM50278320 [N-]=C=[Se]
BDBM50278321 [O-]S(=O)(=O)NS([O-])(=O)=O
BDBM50278322 [O-]S(F)(=O)=O
BDBM50278323 [S-]C([S-])=S
BDBM50333131 [O-][V]([O-])(=O)O[V]([O-])([O-])=O
BDBM26980 [Br-]
BDBM26979 [Cl-]
BDBM26978 [F-]
BDBM26981 [I-]
BDBM60995 [O-][N+]#[C-]
BDBM62293 [S-]C#N
BDBM62319 [O-]B1OB2OB([O-])OB(O1)O2