BindingDB logo
myBDB logout

14 SMILES Strings for β-Carbonic anhydrase (CA)

Compound NameSMILES String
BDBM10880 CC(=O)Nc1nnc(s1)S(N)(=O)=O
BDBM50607 Oc1ccc(cc1)C(=O)\C=C\c1cccnc1
BDBM248148 CNCCNCc1cc(ccc1O)C(=O)\C=C\c1cccnc1
BDBM248152 Oc1ccc(cc1CN1CCCCC1)C(=O)\C=C\c1ccccn1
BDBM248151 Oc1ccc(cc1CN1CCCC1)C(=O)\C=C\c1ccccn1
BDBM248143 Oc1ccc(cc1)C(=O)\C=C\c1ccccn1
BDBM248144 CN(C)Cc1cc(ccc1O)C(=O)\C=C\c1cccnc1
BDBM248145 CCN(CC)Cc1cc(ccc1O)C(=O)\C=C\c1cccnc1
BDBM248146 Oc1ccc(cc1CN1CCCC1)C(=O)\C=C\c1cccnc1
BDBM248147 Oc1ccc(cc1CN1CCCCC1)C(=O)\C=C\c1cccnc1
BDBM248149 CN(C)Cc1cc(ccc1O)C(=O)\C=C\c1ccccn1
BDBM248150 CCN(CC)Cc1cc(ccc1O)C(=O)\C=C\c1ccccn1
BDBM248154 OCCNCc1cc(ccc1O)C(=O)\C=C\c1ccccn1
BDBM248153 CNCCNCc1cc(ccc1O)C(=O)\C=C\c1ccccn1