BindingDB logo
myBDB logout

14 SMILES Strings for β-Carbonic anhydrase (CA1)

Compound NameSMILES String
BDBM36181 [O-]C(=O)c1ccccc1
BDBM36182 CCCCC([O-])=O
BDBM92964 [O-]C(=O)C([O-])=O
BDBM92494 OC(CC([O-])=O)(CC([O-])=O)C([O-])=O
BDBM50079401 CCCC([O-])=O
BDBM50155538 [O-]C=O
BDBM50159792 CC(=O)C([O-])=O
BDBM50159793 CC([O-])=O
BDBM50159794 CC(O)C([O-])=O
BDBM50159796 [O-]C(=O)c1c(F)c(F)cc(F)c1F
BDBM50159797 [O-]C(=O)CC([O-])=O
BDBM50159798 OC(CC([O-])=O)C([O-])=O
BDBM50257201 CCC([O-])=O
BDBM50257203 [O-]C(=O)\C=C/C([O-])=O