BindingDB logo
myBDB logout

22 SMILES Strings for β-Carbonic anhydrase 3 (CA 3)

Compound NameSMILES String
BDBM4375 OC(=O)\C=C\c1ccc(O)c(O)c1
BDBM4374 OC(=O)\C=C\c1ccc(O)cc1
BDBM10857 Nc1ccc(cc1)S(N)(=O)=O
BDBM10886 NS(=O)(=O)c1nnc(NS(=O)(=O)c2ccccc2)s1
BDBM11607 Nc1c(F)cc(cc1I)S(N)(=O)=O
BDBM11608 Nc1c(Cl)cc(cc1Cl)S(N)(=O)=O
BDBM11605 Nc1c(F)cc(cc1Cl)S(N)(=O)=O
BDBM11606 Nc1c(F)cc(cc1Br)S(N)(=O)=O
BDBM11609 Nc1c(Cl)cc(cc1Br)S(N)(=O)=O
BDBM11610 Nc1c(Cl)cc(cc1I)S(N)(=O)=O
BDBM11611 Nc1c(Br)cc(cc1Br)S(N)(=O)=O
BDBM11622 Nc1ccc(cc1Cl)S(=O)(=O)Nc1nnc(s1)S(N)(=O)=O
BDBM11626 Nc1c(F)cc(cc1Br)S(=O)(=O)Nc1nnc(s1)S(N)(=O)=O
BDBM11627 Nc1c(F)cc(cc1I)S(=O)(=O)Nc1nnc(s1)S(N)(=O)=O
BDBM50003624 OC(=O)C1CCCNC1
BDBM50146462 OC(=O)\C=C\c1ccccc1O
BDBM50214744 COc1cc(\C=C\C(O)=O)ccc1O
BDBM50405325 OC(=O)c1ccc(I)cc1
BDBM50405310 OC(=O)c1ccc(cc1)[N+]([O-])=O
BDBM239163 OC(=O)c1ccc(Br)cc1
BDBM239164 OC(=O)c1ccc(cc1)C#N
BDBM239165 CC(=O)Nc1ccc(cc1)C(O)=O