BindingDB logo
myBDB logout

12 SMILES Strings for β-glucosidase

Compound NameSMILES String
BDBM108215 OCC1C(O)C(O)C(O)c2nccn12
BDBM108216 OCC1C(O)C(O)C(O)c2nc(CCc3ccccc3)cn12
BDBM108217 CC(C)(C)CCc1cn2C(CO)C(O)C(O)C(O)c2n1
BDBM108218 CCCCCCCCc1cn2C(CO)C(O)C(O)C(O)c2n1
BDBM108219 Cc1ccc(CCCc2cn3C(CO)C(O)C(O)C(O)c3n2)cc1
BDBM108220 COc1ccc(CCCc2cn3C(CO)C(O)C(O)C(O)c3n2)cc1
BDBM108221 OCC1C(O)C(O)C(O)c2nc(CCCc3ccc(cc3)-c3ccccc3)cn12
BDBM108222 OCC1C(O)C(O)C(O)c2nc(CCCc3ccc(cc3)C3CCCCC3)cn12
BDBM108223 OCC1C(O)C(O)C(O)c2nc(CCCc3ccc(F)cc3)cn12
BDBM108224 OCC1C(O)C(O)C(O)c2nc(CCCC(=O)Nc3ccccc3)cn12
BDBM108225 CC(C)(CCCc1cn2C(CO)C(O)C(O)C(O)c2n1)C(=O)Nc1ccccc1
BDBM50156357 CCCCCCCCCN1CC(O)C(O)C(O)C1CO