BindingDB logo
myBDB logout

1 SMILES String for β-ketoacyl-ACP synthase I (C171Q KasA)

Compound NameSMILES String
BDBM214777 C\C(C=C)=C/[C@@]1(C)SC(=O)C(CCCCN=[N+]=[N-])=C1O |r,c:17|