BindingDB logo
myBDB logout

20 SMILES Strings for β-lactamase (Bla2)

Compound NameSMILES String
BDBM21642 C[C@H](CS)C(=O)N1CCC[C@H]1C(O)=O
BDBM63710 OC(=O)c1csc(n1)-c1ccccc1
BDBM50330325 OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
BDBM50335803 Cc1occc(=S)c1O
BDBM50421214 Nc1cccc(c1)C1=N[C@@H](CS1)C(O)=O |r,t:8|
BDBM50421215 CC(=O)Nc1cccc(c1)C1=N[C@@H](CS1)C(O)=O |r,t:11|
BDBM50421216 CC(C)(C)OC(=O)Nc1cccc(c1)C1=N[C@@H](CS1)C(O)=O |r,t:15|
BDBM50421218 COc1cccc(CC(=O)NCC2=N[C@@H](CS2)C(O)=O)c1 |r,t:12|
BDBM50421219 CC(C)(C)OC(=O)NCC1=N[C@@H](CS1)C(O)=O |r,t:9|
BDBM50421220 OC(=O)[C@@H]1CSC(=N1)c1ccccc1 |r,c:6|
BDBM50421221 OC(=O)c1csc(Cc2ccccc2)n1
BDBM50421222 OC(=O)[C@H]1CSC(=N1)c1ccccc1 |r,c:6|
BDBM50421223 OC(=O)[C@@H]1CSC(Cc2ccccc2)N1 |r|
BDBM50421224 OC(=O)[C@@H]1CSC(N1)c1ccccc1 |r|
BDBM50421225 OC(=O)[C@@H]1CSC(=N1)c1ccc(Br)cc1 |r,c:6|
BDBM50421226 OC(=O)[C@@H]1CSC(=N1)c1ccccc1O |r,c:6|
BDBM50421227 OC(=O)[C@@H]1CSC(CNC(=O)OCc2ccccc2)=N1 |r,c:19|
BDBM50421228 OC(=O)[C@@H]1CSC(Cc2ccccc2)=N1 |r,c:14|
BDBM50421229 OC(=O)[C@@H]1CSC(=N1)c1ccc(Cl)cc1 |r,c:6|
BDBM50421217 OC(=O)[C@@H]1CSC(CNC(=O)Cc2ccccc2)=N1 |r,c:18|