BindingDB logo
myBDB logout

2 SMILES Strings for (E)-1-hydroxy-2-methyl-but-2-enyl 4-diphosphate reductase (IspH)

Compound NameSMILES String
BDBM228817 CCN1CCN2C(C1)C1(Cc3cc(N)ccc23)C(=O)NC(=O)NC1=O
BDBM228818 Nc1ccc2N3CCN(Cc4ccccc4)CC3C3(Cc2c1)C(=O)NC(=O)NC3=O