BindingDB logo
myBDB logout

46 SMILES Strings for HDAC4 (aa 2-1084)

Compound NameSMILES String
BDBM187138 CC(=O)Nc1cnc(cn1)-c1noc(n1)C(F)(F)F
BDBM187177 FC(F)(F)c1nc(no1)-c1cnc(NC(=O)c2ccc(cc2)C#N)cn1
BDBM187187 CN(Cc1ccncc1)c1ncc(cn1)-c1noc(n1)C(F)(F)F
BDBM187213 FC(F)(F)c1nc(no1)-c1cnc(NCc2ccccc2)nc1
BDBM187214 CN(Cc1ccnc(Cl)c1)c1ncc(cn1)-c1noc(n1)C(F)(F)F
BDBM187215 FC(F)(F)c1nc(no1)-c1cnc(NCc2ccncc2)nc1
BDBM187218 Cc1ccc(CNc2ncc(cn2)-c2noc(n2)C(F)(F)F)cn1
BDBM187219 CC(Nc1ncc(cn1)-c1noc(n1)C(F)(F)F)c1ccncc1
BDBM187217 CC(Nc1ncc(cn1)-c1noc(n1)C(F)(F)F)c1ccccc1
BDBM187220 FC(F)(F)c1nc(no1)-c1cnc(NCc2cccnc2)nc1
BDBM187221 Cc1cccc(CNc2ncc(cn2)-c2noc(n2)C(F)(F)F)n1
BDBM187222 C[C@@H](Nc1ncc(cn1)-c1noc(n1)C(F)(F)F)c1ccccc1 |r|
BDBM187223 CC[C@@H](Nc1ncc(cn1)-c1noc(n1)C(F)(F)F)c1ccccc1 |r|
BDBM187224 CN(CCc1ccncc1)c1ncc(cn1)-c1noc(n1)C(F)(F)F
BDBM187232 CCC(Nc1ncc(cn1)-c1noc(n1)C(F)(F)F)c1ccncc1
BDBM187242 CC(Nc1ncc(cn1)-c1noc(n1)C(F)(F)F)c1ccnc(C)c1
BDBM187244 CN(Cc1ccnc(C)c1)c1ncc(cn1)-c1noc(n1)C(F)(F)F
BDBM187246 C[C@H](CN(C)C)NC(=O)c1ccc(nc1)-c1noc(n1)C(F)(F)F |r|
BDBM187307 CC(CN(C)C)NC(=O)c1ccc(nc1)-c1noc(n1)C(F)(F)F
BDBM187399 C[C@@H](CO)NC(=O)c1ccc(nc1)-c1noc(n1)C(F)(F)F |r|
BDBM187543 C[C@H](CN(C)Cc1ccccc1)NC(=O)c1ccc(nc1)-c1noc(n1)C(F)(F)F |r|
BDBM187547 CCN(CC)C[C@H](NC(=O)c1ccc(nc1)-c1noc(n1)C(F)(F)F)C(C)C |r|
BDBM187565 CCN(CC)C[C@@H](C)NC(=O)c1ccc(nc1)-c1noc(n1)C(F)(F)F |r|
BDBM187566 C[C@H](CN(C)C)NC(=O)c1ccc(cn1)-c1noc(n1)C(F)(F)F |r|
BDBM187569 C[C@H](CN(C)C)NC(=O)c1ncc(cc1Cl)-c1noc(n1)C(F)(F)F |r|
BDBM187604 C[C@H](CN(C)C)NC(=O)c1cnc(nc1)-c1noc(n1)C(F)(F)F |r|
BDBM187610 FC(F)(F)c1nc(no1)-c1ccc(NCc2ccccc2)cn1
BDBM187617 FC(F)(F)c1nc(no1)-c1ccc(NCc2ccccc2)nc1
BDBM187628 CC(Nc1ccc(cn1)-c1noc(n1)C(F)(F)F)c1ccccc1
BDBM187629 FC(F)(F)c1nc(no1)-c1ccc(NCc2cccnc2)nc1
BDBM187638 FC(F)(F)c1nc(no1)-c1ccc(NCc2ccncc2)nc1
BDBM187639 Cc1ccc(CNc2ccc(cn2)-c2noc(n2)C(F)(F)F)cn1
BDBM187640 FC(F)(F)c1nc(no1)-c1cnc(NCc2ccccc2)c(Cl)c1
BDBM187642 C[C@@H](Nc1ncc(cc1Cl)-c1noc(n1)C(F)(F)F)c1ccccc1 |r|
BDBM187643 FC(F)(F)c1nc(no1)-c1cnc(NCc2ccncc2)c(Cl)c1
BDBM187784 CC(Nc1ncc(cc1Cl)-c1noc(n1)C(F)(F)F)c1ccncc1
BDBM187802 FC(F)(F)c1nc(no1)-c1cnc(NCc2cccnc2)c(Cl)c1
BDBM187803 Cc1ccc(CNc2ncc(cc2Cl)-c2noc(n2)C(F)(F)F)cn1
BDBM187804 FC(F)(F)c1nc(no1)-c1cnc(NCc2ccccn2)c(Cl)c1
BDBM187993 FC(F)(F)c1nc(no1)-c1ccc(NCc2ccccc2)nn1
BDBM188006 C[C@@H](Nc1cnc(nc1)-c1noc(n1)C(F)(F)F)c1ccccc1 |r|
BDBM188008 C[C@H](Nc1cnc(nc1)-c1noc(n1)C(F)(F)F)c1ccccc1 |r|
BDBM188027 FC(F)(F)c1nc(no1)-c1ncc(NCc2ccncc2)cn1
BDBM188028 C[C@@H](Nc1ccc(cn1)-c1noc(n1)C(F)(F)F)c1ccncc1 |r|
BDBM188029 C[C@@H](Nc1ccc(nn1)-c1noc(n1)C(F)(F)F)c1ccncc1 |r|
BDBM188075 C[C@H](CN(C)Cc1ccccc1)NC(=O)c1cnc(nc1)-c1noc(n1)C(F)(F)F |r|