BindingDB logo
myBDB logout

31 SMILES Strings for 1,4-Dihydroxy-2-naphthoyl-CoA synthase

Compound NameSMILES String
BDBM50329082 COC(=O)Cc1nc2c(C)cccc2oc1=O
BDBM50329083 COC(=O)Cc1nc2cc(C)ccc2oc1=O
BDBM50329084 COC(=O)Cc1nc2cc(F)ccc2oc1=O
BDBM50329085 COC(=O)Cc1nc2cc(Cl)ccc2oc1=O
BDBM50329086 COC(=O)Cc1nc2cc(ccc2oc1=O)[N+]([O-])=O
BDBM50329087 CCS(=O)(=O)c1ccc2oc(=O)c(CC(=O)OC)nc2c1
BDBM50329088 COC(=O)Cc1nc2ccc(C)cc2oc1=O
BDBM50329089 COC(=O)Cc1nc2ccc(F)cc2oc1=O
BDBM50329090 COC(=O)Cc1nc2ccc(Cl)cc2oc1=O
BDBM50329091 COC(=O)Cc1nc2ccc(cc2oc1=O)[N+]([O-])=O
BDBM50329092 COC(=O)Cc1nc2ccccc2[nH]c1=O
BDBM50329093 COC(=O)Cc1nc2ccccc2sc1=O
BDBM50329094 COC(=O)Cc1nc2ccccc2oc1=O
BDBM50382338 CC(C)(COP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP(O)(O)=O)n1cnc2c(N)ncnc12)[C@@H](O)C(=O)NCCC(=O)NCCSC(CC(=O)c1ccc(Cl)cc1Cl)C(O)=O |r|
BDBM50382339 CC(C)(COP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP(O)(O)=O)n1cnc2c(N)ncnc12)[C@@H](O)C(=O)NCCC(=O)NCCSC(CC(=O)c1ccccc1Cl)C(O)=O |r|
BDBM50382340 COc1ccccc1C(=O)CC(N[C@@H](C)c1ccccc1)C(O)=O |r|
BDBM50382341 C[C@H](NC(CC(=O)c1ccccc1C(F)(F)F)C(O)=O)c1ccccc1 |r|
BDBM50382342 C[C@H](NC(CC(=O)c1ccccc1Cl)C(O)=O)c1ccccc1 |r|
BDBM50382343 C[C@H](NC(CC(=O)c1ccc(Cl)cc1)C(O)=O)c1ccccc1 |r|
BDBM50382344 C[C@H](NC(CC(=O)c1ccc(F)cc1)C(O)=O)c1ccccc1 |r|
BDBM50382345 CC(C)(COP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP(O)(O)=O)n1cnc2c(N)ncnc12)[C@@H](O)C(=O)NCCC(=O)NCCSCCC(=O)c1ccc(Cl)cc1Cl |r|
BDBM50382346 CC(C)(COP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP(O)(O)=O)n1cnc2c(N)ncnc12)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)CCC(=O)c1ccc(Cl)cc1Cl |r|
BDBM50382351 CC(C)(COP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP(O)(O)=O)n1cnc2c(N)ncnc12)[C@@H](O)C(=O)NCCC(=O)NCCSC(CC(=O)c1ccccc1Br)C(O)=O |r|
BDBM50382347 CC(C)(COP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP(O)(O)=O)n1cnc2c(N)ncnc12)[C@@H](O)C(=O)NCCC(=O)NCCSC(CC(=O)c1cccc(Cl)c1)C(O)=O |r|
BDBM50382348 COc1ccccc1C(=O)CC(SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP(O)(O)=O)n1cnc2c(N)ncnc12)C(O)=O |r|
BDBM50382352 CC(C)(COP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP(O)(O)=O)n1cnc2c(N)ncnc12)[C@@H](O)C(=O)NCCC(=O)NCCSC(CC(=O)c1ccccc1F)C(O)=O |r|
BDBM50382353 COc1ccc(cc1)C(=O)CC(SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP(O)(O)=O)n1cnc2c(N)ncnc12)C(O)=O |r|
BDBM50382354 C[C@H](NC(CC(=O)c1ccccc1)C(O)=O)c1ccccc1 |r|
BDBM50382349 CC(C)(COP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP(O)(O)=O)n1cnc2c(N)ncnc12)[C@@H](O)C(=O)NCCC(=O)NCCSC(CC(=O)c1ccccc1[N+]([O-])=O)C(O)=O |r|
BDBM50382350 CC(C)(COP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP(O)(O)=O)n1cnc2c(N)ncnc12)[C@@H](O)C(=O)NCCC(=O)NCCSC(CC(=O)c1ccccc1I)C(O)=O |r|
BDBM50382337 CC(C)(COP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP(O)(O)=O)n1cnc2c(N)ncnc12)[C@@H](O)C(=O)NCCC(=O)NCCSC(CC(=O)c1ccc(Cl)cc1)C(O)=O |r|