BindingDB logo
myBDB logout

8 SMILES Strings for 1-Deoxy-D-xylulose-5-phosphate synthase (DXP synthase))

Compound NameSMILES String
BDBM108226 Cc1ccccc1N=O
BDBM108227 CN(C)c1ccc(cc1)N=O
BDBM108228 Oc1ccc2ccccc2c1N=O
BDBM108229 Oc1ccc2cc(Br)ccc2c1N=O
BDBM108230 NS(=O)(=O)c1ccc2c(N=O)c(O)ccc2c1
BDBM108231 COc1ccc2ccc(O)c(N=O)c2c1
BDBM108232 CC(C)n1nc(C)c(N=O)c1C
BDBM50065935 O=Nc1ccccc1