BindingDB logo
myBDB logout

38 SMILES Strings for 1-deoxy-D-xylulose-5-phosphate synthase

Compound NameSMILES String
BDBM40457 Cc1nc2c(c([nH]n2c(=O)c1Cc1ccccc1)C(F)(F)F)-c1ccc(Cl)cc1
BDBM51305 FC(F)(F)c1[nH]n2c(nc(cc2=O)-c2ccccc2)c1-c1ccccc1
BDBM58242 COc1ccc(cc1)-c1c([nH]n2c1nc(cc2=O)-c1ccccc1)C(F)(F)F
BDBM92962 Cc1c(CCOP(O)(=O)OP(O)(O)=O)sc[n+]1Cc1cnc(C)nc1N
BDBM50263874 CCOC(=O)Cc1c(C)nc2c(cnn2c1O)-c1ccccc1
BDBM50264089 COCc1cc(O)n2nc(C)c(-c3ccc(Cl)cc3)c2n1
BDBM50263872 COCc1cc(=O)n2[nH]cc(-c3ccc(Cl)cc3)c2n1
BDBM50263873 Cc1cc(=O)n2[nH]cc(-c3ccc(Cl)cc3)c2n1
BDBM50263875 ClCc1cc(=O)n2[nH]cc(-c3ccccc3)c2n1
BDBM50263817 Clc1ccc(cc1)-c1c[nH]n2c1nc(Cc1ccccc1)cc2=O
BDBM50263925 FC(F)(F)c1[nH]n2c(nc(Cc3ccccc3)cc2=O)c1-c1ccc(Cl)cc1
BDBM50263927 COC(=O)Cc1cc(=O)n2[nH]c(c(-c3ccc(Br)cc3)c2n1)C(F)(F)F
BDBM50263928 Cc1cc(=O)n2[nH]c(c(-c3ccc(Br)cc3)c2n1)C(F)(F)F
BDBM50263929 Cc1cc(=O)n2[nH]c(c(-c3ccc(Cl)cc3)c2n1)C(F)(F)F
BDBM50263969 COc1ccc(cc1)-c1c(C)[nH]n2c1nc(cc2=O)-c1ccccc1
BDBM50263970 COc1ccc(cc1)-c1c(C)[nH]n2c1nc(cc2=O)-c1ccc(OC)cc1
BDBM50263971 Cc1[nH]n2c(nc(cc2=O)-c2ccccc2)c1-c1ccc(Cl)cc1
BDBM50263972 COc1ccc(cc1)-c1cc(=O)n2[nH]c(C)c(-c3ccc(Cl)cc3)c2n1
BDBM50263344 FC(F)(F)c1cc(nc2c(cnn12)-c1ccc(Cl)cc1)-c1ccc(Cl)cc1
BDBM50263345 Brc1cccc(c1)-c1cnn2c(cc(nc12)-c1ccccc1)-c1ccccc1
BDBM50264088 Cc1[nH]n2c(nc(CSc3ccc(Cl)cc3)cc2=O)c1-c1ccccc1
BDBM50264090 Cc1[nH]n2c(nc(cc2=O)-c2ccc3ccccc3c2)c1-c1ccccc1
BDBM50264091 CCCc1c(nc2c(c(C)[nH]n2c1=O)-c1ccccc1)-c1ccccc1
BDBM50264092 CCc1[nH]n2c(nc(cc2=O)-c2ccc(OC)cc2)c1-c1ccc(Cl)cc1
BDBM50264033 COc1ccc(cc1)-c1cc(=O)n2[nH]c(C)c(-c3ccc(F)cc3)c2n1
BDBM50264034 COc1ccccc1-c1cc(=O)n2[nH]c(C)c(-c3ccc(Br)cc3)c2n1
BDBM50264035 Cc1[nH]n2c(nc(cc2=O)-c2ccccc2)c1-c1ccccc1
BDBM50264036 Cc1[nH]n2c(nc(CSc3nnnn3-c3ccccc3)cc2=O)c1-c1ccc(Cl)cc1
BDBM50264037 Cc1[nH]n2c(nc(CSc3ccc(Cl)cc3)cc2=O)c1-c1ccc(Cl)cc1
BDBM50263876 FC(F)(F)c1[nH]n2c(nc(Cc3ccccc3)cc2=O)c1-c1ccccc1
BDBM50373886 Cc1c(Cc2cnc(C)nc2N)csc1CCO
BDBM50026312 CCOP(O)(=O)C(C)=O
BDBM50026349 CC1(C)C(=O)ON(Cc2ccccc2Cl)C1=O
BDBM50026326 CCCCOP(O)(=O)C(C)=O
BDBM50026348 CC(=O)P(O)(=O)OCc1ccccc1
BDBM50026350 CC(C)(C(O)=O)C(=O)N(O)Cc1ccccc1Cl
BDBM50026351 CC(C)(CO)C(=O)N(O)Cc1ccccc1Cl
BDBM50026352 FC(F)(F)Oc1cccc(Cn2cnc3ccccc23)c1