BindingDB logo
myBDB logout

6 SMILES Strings for 1-deoxyxylulose-5-phosphate reductoisomerase

Compound NameSMILES String
BDBM50153710 CC(=O)[C@@H](O)CCOP([O-])([O-])=O
BDBM50153711 NC(=O)[C@@H](O)[C@H](O)COP([O-])([O-])=O
BDBM50153712 CC(=O)[C@@H](O)[C@@H](O)COP([O-])([O-])=O
BDBM50153713 ON(CCCP(O)(O)=O)C=O
BDBM50153714 CC(=O)C[C@H](O)COP([O-])([O-])=O
BDBM50153715 CCC(=O)[C@@H](O)[C@H](O)COP([O-])([O-])=O