BindingDB logo
myBDB logout

13 SMILES Strings for 1-phosphatidylinositol-4,5-bisphosphate phosphodiesterase gamma-1

Compound NameSMILES String
BDBM50082305 CCCCCCCCCCCCCCCc1cccc(O)c1
BDBM50129952 Oc1ccc(cc1)-c1cc(=O)c2c(O)cc(O)c(-c3cc(ccc3O)-c3cc(O)c4c(cc(O)cc4=O)o3)c2o1 |(13.25,-26.01,;14.59,-25.24,;14.59,-23.7,;15.92,-22.93,;17.26,-23.7,;17.26,-25.24,;15.93,-26.01,;18.58,-22.93,;19.91,-23.69,;21.23,-22.92,;22.57,-23.69,;21.22,-21.4,;22.56,-20.64,;23.88,-21.41,;22.55,-19.1,;21.22,-18.33,;21.22,-16.79,;19.9,-19.11,;18.57,-18.34,;17.23,-19.1,;15.9,-18.33,;15.9,-16.79,;17.23,-16.02,;18.57,-16.79,;19.91,-16.02,;14.57,-19.09,;14.56,-20.65,;13.21,-21.42,;13.21,-22.96,;11.87,-20.64,;11.88,-19.08,;10.54,-18.32,;9.21,-19.09,;7.87,-18.32,;9.21,-20.64,;10.54,-21.41,;10.54,-22.95,;13.22,-18.3,;19.9,-20.64,;18.58,-21.4,)|
BDBM50242263 CCCCCC\C=C/CCCCCCCc1cccc(O)c1
BDBM50241751 CCCCCC\C=C/CCCCCCCc1cc(O)cc(O)c1
BDBM50242188 CCCCCC\C=C/CCCCCCCc1cccc(O)c1C(O)=O
BDBM50259927 CCCCCC\C=C/CCCCCCCCCc1cccc(O)c1
BDBM50259929 CCCCCCCCCCCCCc1cccc(O)c1
BDBM50259930 CCCCCC\C=C/CCCCCCCCCc1cccc(O)c1C(O)=O
BDBM50259931 CCCCCCCCCCCCCc1cccc(O)c1C(O)=O
BDBM50259932 CCCCCC\C=C/CCCCCCCCCc1cc(O)cc(O)c1
BDBM50259933 CCCCCCCCCCCCCc1cc(O)cc(O)c1
BDBM50259934 CC(=O)c1cc2c(oc3cc(O)c(O)c(C(O)=O)c3c2=O)c(C(C)=O)c1-c1coc2cc(O)c(O)c(C(O)=O)c2c1=O |(20.43,6.8,;19.44,5.59,;17.89,5.83,;20.23,4.23,;21.56,5,;22.9,4.23,;22.9,2.7,;24.24,1.92,;25.57,2.7,;26.89,1.92,;28.22,2.7,;29.56,1.92,;28.22,4.23,;29.56,5,;26.89,5,;26.89,6.56,;28.24,7.35,;25.53,7.35,;25.57,4.23,;24.24,5,;24.24,6.56,;21.56,1.92,;21.56,.39,;20.23,-.38,;22.9,-.38,;20.23,2.7,;18.87,1.94,;18.85,.4,;17.49,-.34,;16.18,.44,;14.83,-.3,;13.52,.49,;12.17,-.25,;13.54,2.03,;12.22,2.82,;14.88,2.78,;14.9,4.35,;13.57,5.14,;16.27,5.1,;16.2,1.99,;17.56,2.73,;17.58,4.3,)|
BDBM50259935 C[C@@H]1CC[C@@H]2[C@]3(C)O[C@]4(C)CC[C@]12C[C@@H]4[C@@H]3NCCCCN(C)CCCN(C)C |r,TLB:3:4:15:8.7,1:12:15:8.7,11:12:15:8.7|