BindingDB logo
myBDB logout

2 SMILES Strings for 11-beta-hydroxysteroid dehydrogenase type 1

Compound NameSMILES String
BDBM50273458 C[C@H](NC1=NC(=O)[C@@](C)(S1)C(C)(C)O)c1ccc(F)cc1 |r,t:3|
BDBM50392216 CCCSc1nc(ccc1C(=O)NC1CCCCC1)N1CCC[C@@H](CC(O)=O)C1 |r|