BindingDB logo
myBDB logout

2 SMILES Strings for 14-3-3 protein sigma

Compound NameSMILES String
BDBM50356015 CCCCCCOC(=O)c1ccc(Nc2c(cc(cc2[N+]([O-])=O)C(O)=O)[N+]([O-])=O)cc1
BDBM50177030 OP(O)(=O)c1ccccc1OCC(=O)Nc1cccc(Cl)c1Cl