BindingDB logo
myBDB logout

15 SMILES Strings for 15-Lipoxygenase (LoxA)

Compound NameSMILES String
BDBM20607 CC\C(=C(/c1ccccc1)c1ccc(OCCN(C)C)cc1)c1ccccc1
BDBM21383 O=C(CCCCCN1CCN(CC1)c1ccccc1-c1ccccc1)NC1CCCc2ccccc12
BDBM22873 CC(C)(C)c1ccc(cc1)C(=O)CCCN1CCC(CC1)OC(c1ccccc1)c1ccccc1
BDBM22165 Fc1ccc(cc1)C(OCCN1CCN(CCCc2ccccc2)CC1)c1ccc(F)cc1
BDBM26948 Fc1ccc(cc1)C(CCCN1CCC2(CC1)N(CNC2=O)c1ccccc1)c1ccc(F)cc1
BDBM79021 CN[C@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccccc12
BDBM50017702 Fc1ccc(cc1)C(N1CCN(C\C=C\c2ccccc2)CC1)c1ccc(F)cc1
BDBM50017712 CO[C@H]1[C@@H](C[C@@H]2CN3CCc4c([nH]c5cc(OC)ccc45)[C@H]3C[C@@H]2[C@@H]1C(=O)OC)OC(=O)c1cc(OC)c(OC)c(OC)c1 |r|
BDBM190651 CCCCCCc1ccc(Oc2ccccc2F)c(O)c1
BDBM190652 CCCCCCc1ccn(Cc2ccccc2C)c(=O)c1
BDBM50092228 Nc1ncnc2n(cc(-c3ccc(Oc4ccccc4)cc3)c12)C1CCCC1
BDBM50334150 Fc1ccc(cc1)C(CCCN1CCC(CC1)n1c2ccccc2[nH]c1=O)c1ccc(F)cc1
BDBM50329323 O=C(OCC#CCSc1nnc(o1)-c1cccc2ccccc12)c1ccccc1
BDBM32020 CC(Cc1ccc(O)c(O)c1)C(C)Cc1ccc(O)c(O)c1
BDBM190650 CCCCCCc1ccc(Oc2ccccc2Cl)c(O)c1