BindingDB logo
myBDB logout

13 SMILES Strings for 15-Lipoxygenase (SLO)

Compound NameSMILES String
BDBM50164168 COc1cc(CC=C)ccc1O
BDBM50379791 COc1ccc(CC=C)cc1OC
BDBM192757 COc1cccc(CC=C)c1OC
BDBM234362 CCC(C)Oc1ccc(OC)cc1CC=C
BDBM234363 COc1ccc(OCC(C)C)c(CC=C)c1
BDBM234364 COc1ccc(OC(C)(C)C)c(CC=C)c1
BDBM234365 COc1ccc(OC2CCCC2)c(CC=C)c1
BDBM234366 COc1ccc(OC2CCCCC2)c(CC=C)c1
BDBM234358 CCOc1ccc(OC)cc1CC=C
BDBM234357 COc1ccc(OC)c(CC=C)c1
BDBM234359 CCCOc1ccc(OC)cc1CC=C
BDBM234360 COc1ccc(OC(C)C)c(CC=C)c1
BDBM234361 CCCCOc1ccc(OC)cc1CC=C