BindingDB logo
myBDB logout

12 SMILES Strings for 17-beta-hydroxysteroid-dehydrogenase

Compound NameSMILES String
BDBM50149606 O=C(Oc1ccc(cc1)C#N)\C=C\c1ccccc1
BDBM50149607 O=C(OCc1ccccc1)c1cc2ccccc2oc1=O
BDBM50149608 CC(=O)Nc1ccc(OC(=O)\C=C\c2ccccc2)cc1
BDBM50149609 O=C(OCc1ccccc1)\C=C\c1ccccc1
BDBM50149610 COc1cccc(OC(=O)\C=C\c2ccccc2)c1
BDBM50149611 COc1cc(COC(=O)\C=C\c2ccccc2)cc(OC)c1OC
BDBM50149612 O=C(Oc1ccccc1)\C=C\c1ccccc1
BDBM50149613 O=C(Oc1cccc2ccccc12)\C=C\c1ccccc1
BDBM50149614 O=C(OCN1C(=O)c2ccccc2C1=O)\C=C\c1ccccc1
BDBM50149603 O=C(OCCN1C(=O)c2ccccc2C1=O)\C=C\c1ccccc1
BDBM50149604 O=C(OCc1cccc(Oc2ccccc2)c1)\C=C\c1ccccc1
BDBM50149605 CCCCCCCC(=O)Nc1ccc(OC(=O)\C=C\c2ccccc2)cc1