BindingDB logo
myBDB logout

7 SMILES Strings for 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase

Compound NameSMILES String
BDBM50194153 Nc1ccn([C@@H]2O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]2O)c(=O)n1
BDBM50443770 Nc1ccn([C@@H]2O[C@H](CNC(=O)c3cn4ccsc4n3)[C@@H](O)[C@H]2O)c(=O)n1 |r|
BDBM50443771 Nc1ccn([C@@H]2O[C@H](CNC(=O)Cc3cn4ccsc4n3)[C@@H](O)[C@H]2O)c(=O)n1 |r|
BDBM50443772 Nc1ccn([C@@H]2O[C@H](CNC(=O)c3ccncc3)[C@@H](O)[C@H]2O)c(=O)n1 |r|
BDBM50443773 OCc1cn2ccsc2n1
BDBM50443774 Nc1ccn([C@@H]2O[C@H](CNC(=O)c3ccnc4nc[nH]c34)[C@@H](O)[C@H]2O)c(=O)n1 |r|
BDBM50443775 Nc1ccn([C@@H]2O[C@H](CNC(=O)c3cscn3)[C@@H](O)[C@H]2O)c(=O)n1 |r|