BindingDB logo
myBDB logout

2 SMILES Strings for 2-acylglycerol O-acyltransferase 2

Compound NameSMILES String
BDBM50110581 CC(C)(C)c1ccc(NC(=O)N2Cc3ccc(cc3C2)S(=O)(=O)Nc2ccc(F)cc2)cc1
BDBM50110518 CC(C)(C)c1ccc(CCN2CCc3cc(ccc3C2)S(=O)(=O)Nc2ccc(F)cc2)cc1