BindingDB logo
myBDB logout

22 SMILES Strings for 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase

Compound NameSMILES String
BDBM261513 OC(=O)c1cccc(CSc2nc(-c3ccco3)c(C#N)c(=O)[nH]2)c1
BDBM261516 OC(=O)c1cccc(CSc2nc(-c3ccsc3)c(C#N)c(=O)[nH]2)c1
BDBM261521 OC(=O)c1cccc(CSc2nc(-c3cccs3)c(C#N)c(=O)[nH]2)c1
BDBM261530 OC(=O)c1cccc(CSc2nc(-c3nccs3)c(C#N)c(=O)[nH]2)c1
BDBM261535 OC(=O)c1cccc(CSc2nc(C3CCCCC3)c(C#N)c(=O)[nH]2)c1
BDBM261538 OC(=O)c1cccc(CSc2nc(-c3ccncc3)c(C#N)c(=O)[nH]2)c1
BDBM261540 OC(=O)c1ccc(CSc2nc(-c3ccc(Cl)cc3)c(C#N)c(=O)[nH]2)cc1
BDBM261543 CCOC(=O)c1cccc(CSc2nc(-c3ccc(C)cc3)c(C#N)c(=O)[nH]2)c1
BDBM261555 Cc1nc(SCc2cccc(c2)C(O)=O)[nH]c(=O)c1C#N
BDBM261588 OC(=O)c1cccc(CSc2nc(-c3ccccc3)c(Br)c(=O)[nH]2)c1
BDBM261593 OC(=O)c1cccc(CSc2nc(-c3cccs3)c(Br)c(=O)[nH]2)c1
BDBM261602 OC(=O)c1cccc(CSc2nc(-c3ccccc3)c(Cl)c(=O)[nH]2)c1
BDBM261603 OC(=O)c1cccc(CSc2nc(cc(=O)[nH]2)-c2ccccc2)c1
BDBM261604 OC(=O)c1cccc(CSc2nc(cc(=O)[nH]2)-c2cccs2)c1
BDBM261605 OC(=O)c1ccc(CSc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)cc1
BDBM261606 O=c1[nH]c(SCc2cccc(c2)-c2nn[nH]n2)nc(-c2cccs2)c1C#N
BDBM261607 OC(=O)Cc1cccc(CSc2nc(-c3cccs3)c(C#N)c(=O)[nH]2)c1
BDBM261608 O=c1[nH]c(no1)-c1cccc(CSc2nc(-c3cccs3)c(C#N)c(=O)[nH]2)c1
BDBM261609 CC(Sc1nc(-c2ccccc2)c(C#N)c(=O)[nH]1)C(O)=O
BDBM261610 OC(=O)c1cccc(CSc2nc(Cl)c(C#N)c(n2)-c2ccccc2)c1
BDBM261611 Oc1ccccc1NC(=O)CSc1nc(-c2cccs2)c(C#N)c(=O)[nH]1
BDBM261511 OC(=O)c1cccc(CSc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)c1