BindingDB logo
myBDB logout

60 SMILES Strings for 2-amino-4-hydroxy-6-hydroxymethyldihydropteridin e pyrophosphokinase

Compound NameSMILES String
BDBM50108009 Nc1nc2[nH]c(=S)[nH]c2c(=O)[nH]1
BDBM50125760 Nc1nc2nc(SCc3ccc(Cl)cc3)[nH]c2c(=O)[nH]1
BDBM50031523 Nc1nc2nc(SCC(=O)c3ccccc3)[nH]c2c(=O)[nH]1
BDBM50031522 COc1ccc(cc1)C(=O)CSc1nc2nc(N)[nH]c(=O)c2[nH]1
BDBM50031524 CC(Sc1nc2nc(N)[nH]c(=O)c2[nH]1)C(=O)c1ccccc1
BDBM50031525 COc1ccccc1C(=O)CSc1nc2nc(N)[nH]c(=O)c2[nH]1
BDBM50031526 Nc1nc2[nH]c(SCC(=O)c3ccc(cc3)-c3ccccc3)nc2c(=O)[nH]1
BDBM50031527 COc1ccc(CCSc2nc3c(nc(N)[nH]c3=O)[nH]2)cc1
BDBM50031528 CC(=O)CSc1nc2c(nc(N)[nH]c2=O)[nH]1
BDBM50031529 Nc1nc2[nH]c(SCc3ccccc3)nc2c(=O)[nH]1
BDBM50031531 Nc1nc2[nH]c(SCc3ccccc3F)nc2c(=O)[nH]1
BDBM50031532 Nc1nc2[nH]c(SCc3ccccc3C(F)(F)F)nc2c(=O)[nH]1
BDBM50031533 Nc1nc2nc(SCc3ccc(cc3)C#N)[nH]c2c(=O)[nH]1
BDBM50181848 Nc1nc2[nH]c(SCC(=O)c3ccc(Br)cc3)nc2c(=O)[nH]1
BDBM50181863 Cc1ccccc1CSc1nc2c(nc(N)[nH]c2=O)[nH]1
BDBM50181847 CCN(C)C(=O)C(C)Sc1nc2c(nc(N)[nH]c2=O)[nH]1
BDBM50181865 Nc1nc2[nH]c(SCc3ccccc3Cl)nc2c(=O)[nH]1
BDBM50181866 Nc1nc2[nH]c(SCc3ccccc3Br)nc2c(=O)[nH]1
BDBM50181898 CC(C)CNC(=O)CSc1nc2c(nc(N)[nH]c2=O)[nH]1
BDBM50181899 CN(C)C(=O)CSc1nc2c(nc(N)[nH]c2=O)[nH]1
BDBM50181900 Nc1nc2[nH]c(SCCN3CCCC3=O)nc2c(=O)[nH]1
BDBM50182023 Cc1cccc(CSc2nc3c(nc(N)[nH]c3=O)[nH]2)c1
BDBM50182024 Nc1nc2[nH]c(SCc3cccc(Cl)c3)nc2c(=O)[nH]1
BDBM50182025 Nc1nc2[nH]c(SCc3cccc(Br)c3)nc2c(=O)[nH]1
BDBM50182026 Nc1nc2[nH]c(SCc3ccccc3C#N)nc2c(=O)[nH]1
BDBM50182027 Nc1nc2[nH]c(SCc3cccc(F)c3)nc2c(=O)[nH]1
BDBM50182028 COCCSc1nc2c(nc(N)[nH]c2=O)[nH]1
BDBM50182029 Nc1nc2[nH]c(SCCC3OCCCO3)nc2c(=O)[nH]1
BDBM50181864 Nc1nc2[nH]c(SCc3ccccc3[N+]([O-])=O)nc2c(=O)[nH]1
BDBM50181901 CNC(=O)CSc1nc2c(nc(N)[nH]c2=O)[nH]1
BDBM50182022 COc1cccc(CSc2nc3c(nc(N)[nH]c3=O)[nH]2)c1
BDBM50182021 CCN(CC)C(=O)CSc1nc2c(nc(N)[nH]c2=O)[nH]1
BDBM50181519 Cc1cc(CSc2nc3c(nc(N)[nH]c3=O)[nH]2)ccc1F
BDBM50181521 Nc1nc2[nH]c(SCc3ccc(F)cc3C#N)nc2c(=O)[nH]1
BDBM50181541 Nc1nc2[nH]c(SCc3ccc(cc3)C(F)(F)F)nc2c(=O)[nH]1
BDBM50181514 Nc1nc2[nH]c(SCC(O)C(F)(F)F)nc2c(=O)[nH]1
BDBM50181515 Nc1nc2[nH]c(SCC(O)CO)nc2c(=O)[nH]1
BDBM50181516 Nc1nc2[nH]c(SCCCO)nc2c(=O)[nH]1
BDBM50181517 Nc1nc2[nH]c(SCCO)nc2c(=O)[nH]1
BDBM50181518 Nc1nc2[nH]c(SCc3ccc(F)c(c3)C#N)nc2c(=O)[nH]1
BDBM50181520 Nc1nc2[nH]c(SCc3ccc(F)c(F)c3)nc2c(=O)[nH]1
BDBM50181522 Cc1cc(F)ccc1CSc1nc2c(nc(N)[nH]c2=O)[nH]1
BDBM50181523 Nc1nc2[nH]c(SCc3ccc(cc3F)C#N)nc2c(=O)[nH]1
BDBM50181524 COc1ccc(CSc2nc3c(nc(N)[nH]c3=O)[nH]2)c(F)c1
BDBM50181525 Nc1nc2[nH]c(SCc3ccc(F)cc3F)nc2c(=O)[nH]1
BDBM50181527 Cc1cccc(CSc2nc3c(nc(N)[nH]c3=O)[nH]2)c1F
BDBM50181528 Cc1ccc(C)c(CSc2nc3c(nc(N)[nH]c3=O)[nH]2)c1
BDBM50181529 Cc1cccc(CSc2nc3c(nc(N)[nH]c3=O)[nH]2)c1C
BDBM50181530 Nc1nc2[nH]c(SCc3cc(cc(c3)C(F)(F)F)C(F)(F)F)nc2c(=O)[nH]1
BDBM50181531 Cc1cc(C)cc(CSc2nc3c(nc(N)[nH]c3=O)[nH]2)c1
BDBM50181533 Nc1nc2[nH]c(SCc3c(F)cccc3F)nc2c(=O)[nH]1
BDBM50181543 COc1ccc(CSc2nc3c(nc(N)[nH]c3=O)[nH]2)cc1
BDBM50181545 Nc1nc2[nH]c(SCc3ccc(Br)cc3)nc2c(=O)[nH]1
BDBM50181546 Nc1nc2[nH]c(SCc3ccc(F)cc3)nc2c(=O)[nH]1
BDBM50181548 Nc1nc2[nH]c(SCc3cccc(c3)C(O)=O)nc2c(=O)[nH]1
BDBM50181551 Nc1nc2[nH]c(SCc3cccc(c3)C#N)nc2c(=O)[nH]1
BDBM50181555 Nc1nc2[nH]c(SCc3cccc(c3)[N+]([O-])=O)nc2c(=O)[nH]1
BDBM50181835 Nc1nc2[nH]c(SCc3cccc(OC(F)(F)F)c3)nc2c(=O)[nH]1
BDBM50181526 Cc1ccc(F)c(CSc2nc3c(nc(N)[nH]c3=O)[nH]2)c1
BDBM50181536 Nc1nc2[nH]c(SCc3ccc(OC(F)(F)F)cc3)nc2c(=O)[nH]1