BindingDB logo
myBDB logout

6 SMILES Strings for 2-dehydro-3-deoxyphosphooctonate aldolase

Compound NameSMILES String
BDBM50281349 OC(=O)CNCP(O)(O)=O
BDBM50362544 C[C@@H](OP(O)(O)=O)C(O)=O |r|
BDBM50362545 C[C@H](OP(O)(O)=O)C(O)=O |r|
BDBM50362546 OC(=O)C(CCCCCCOP(O)(O)=O)OP(O)(O)=O
BDBM50362547 OCCCCCCC(OP(O)(O)=O)C(O)=O
BDBM50362548 OC(CCCCCCOP(O)(O)=O)C(O)=O