BindingDB logo
myBDB logout

8 SMILES Strings for 2-oxoglutarate receptor 1

Compound NameSMILES String
BDBM50393117 Clc1cccc(c1)-c1ccc(CNC(=O)CCCc2ccc3cccnc3n2)cc1
BDBM50393123 C[C@H](NC(=O)CCCc1ccc2cccnc2n1)c1ccc(cc1)-c1cccc(Cl)c1 |r|
BDBM50393129 C[C@H](NC(=O)Cc1ccc(cc1)-c1ccc2cccnc2n1)c1ccc(cc1)-c1ccc(F)c(c1)C(F)(F)F |r|
BDBM50393143 Fc1ccc(cc1C(F)(F)F)-c1cc(CNC(=O)CCCc2ccc3cccnc3n2)on1
BDBM50393148 Clc1cccc(c1)-c1ccc(cc1)-c1nnc(CCCc2ccc3cccnc3n2)o1
BDBM50393157 FC(F)(F)Oc1ccc(cc1Cl)-c1nnc(CCCCc2ccc3cccnc3n2)o1
BDBM50393158 FC(F)(F)c1cc(ccc1Cl)-c1nnc(CCCCc2ccc3cccnc3n2)o1
BDBM50393161 Cc1cccc(c1)-c1ccc(CNC(=O)CCCc2ccc3cccnc3n2)cc1