BindingDB logo
myBDB logout

2 SMILES Strings for 20S proteasome

Compound NameSMILES String
BDBM154579 CCCCCC(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCC(=O)N(C)C)C(=O)N[C@@H](CC(C)C)C(=O)[C@@]1(C)CO1 |r|
BDBM154578 CCCCCC(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCS(C)=O)C(=O)N[C@@H](CC(C)C)C(=O)[C@@]1(C)CO1 |r|