BindingDB logo
myBDB logout

49 SMILES Strings for 24-sterol C-methyltransferase

Compound NameSMILES String
BDBM50134724 CCC(=O)N1CCCCC1C(C)(O)[C@H]1CCC2C3CCC4C[C@H](CC[C@]4(C)C3CC[C@]12C)O[Si](C)(C)C(C)(C)C
BDBM50134726 CC(C)(C)[Si](C)(C)O[C@H]1CC[C@@]2(C)C(CCC3C4CC[C@H](C(C)(O)C5CCCNC5)[C@@]4(C)CCC23)C1
BDBM50134727 CC(C)(C)[Si](C)(C)O[C@H]1CC[C@@]2(C)C(CCC3C4CC[C@H](C(C)(O)c5cccnc5)[C@@]4(C)CCC23)C1
BDBM50134728 CC(O)([C@H]1CCC2C3CCC4C[C@@H](O)CC[C@]4(C)C3CC[C@]12C)c1ccncc1Cl
BDBM50134729 CC(C)(C)[Si](C)(C)O[C@H]1CC[C@@]2(C)C(CCC3C4CC[C@H](C(C)(O)c5ccccn5)[C@@]4(C)CCC23)C1
BDBM50134730 CCC(=O)N1CCCC(C1)C(C)(O)[C@H]1CCC2C3CCC4C[C@H](CC[C@]4(C)C3CC[C@]12C)O[Si](C)(C)C(C)(C)C
BDBM50134731 CCC(=O)N1CCCC(C1)C(C)(O)[C@H]1CCC2C3CCC4C[C@@H](O)CC[C@]4(C)C3CC[C@]12C
BDBM50134733 CC(C)(C)[Si](C)(C)O[C@H]1CC[C@@]2(C)C(CCC3C4CC[C@H](C(C)(O)c5ccncc5)[C@@]4(C)CCC23)C1
BDBM50134734 CC(C)(C)[Si](C)(C)O[C@H]1CC[C@@]2(C)C(CCC3C4CC[C@@H](C4CCC23)C(C)(O)c2ccncc2Cl)C1
BDBM50134736 CCC(=O)N1CCCCC1C(C)(O)[C@H]1CCC2C3CCC4C[C@@H](O)CC[C@]4(C)C3CC[C@]12C
BDBM50134737 CC(O)([C@H]1CCC2C3CCC4C[C@@H](O)CC[C@]4(C)C3CC[C@]12C)C1CCCNC1
BDBM50134738 CC(O)([C@H]1CCC2C3CCC4C[C@@H](O)CC[C@]4(C)C3CC[C@]12C)c1cccnc1
BDBM50134723 CC(O)([C@H]1CCC2C3CCC4C[C@@H](O)CC[C@]4(C)C3CC[C@]12C)c1ccncc1
BDBM50195621 COC(=O)CCCCCCNC[C@@H](C)[C@H]1CC[C@H]2C3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OC(C)=O |t:20|
BDBM50195622 COC(=O)CCCCCCCNC[C@@H](C)[C@H]1CC[C@H]2C3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OC(C)=O |t:21|
BDBM50195623 C[C@@H]([C@H]1CC[C@H]2C3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OC(C)=O)C(=O)NCCC[C@H](NC(=O)OCc1ccccc1)C(O)=O |t:8|
BDBM50195624 C[C@@H]([C@H]1CC[C@H]2C3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)C(=O)NCCCCCC(O)=O |t:8|
BDBM50195625 COC(=O)CCNC[C@@H](C)[C@H]1CC[C@H]2C3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OC(C)=O |t:16|
BDBM50195626 C[C@@H]([C@H]1CC[C@H]2C3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)C(=O)NCCC(O)=O |t:8|
BDBM50195627 C[C@@](O)([C@H]1CC[C@H]2C3CC[C@H]4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)C1CCCCN1
BDBM50195628 C[C@@H]([C@H]1CC[C@H]2C3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)C(=O)NCCCCCCC(O)=O |t:8|
BDBM50195629 C[C@H](CNC[C@H](NC(=O)OC(C)(C)C)C(O)=O)[C@H]1CC[C@H]2C3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OC(C)=O |t:23|
BDBM50195630 C[C@@H]([C@H]1CC[C@H]2C3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OC(C)=O)C(=O)NCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |t:8|
BDBM50195631 COC(=O)CCCCCNC[C@@H](C)[C@H]1CC[C@H]2C3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OC(C)=O |t:19|
BDBM50195632 C[C@H](CNCCC[C@H](NC(=O)OCc1ccccc1)C(O)=O)[C@H]1CC[C@H]2C3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OC(C)=O |t:29|
BDBM50195633 COC(=O)CNC[C@@H](C)[C@H]1CC[C@H]2C3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OC(C)=O |t:15|
BDBM50195634 C[C@@H]([C@H]1CC[C@H]2C3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OC(C)=O)C(=O)NCC[C@H](NC(=O)OC(C)(C)C)C(O)=O |t:8|
BDBM50195635 COC(=O)CCCCNC[C@@H](C)[C@H]1CC[C@H]2C3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OC(C)=O |t:18|
BDBM50195636 C[C@H](CNCCCC(O)=O)[C@H]1CC[C@H]2C3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |t:16|
BDBM50195637 C[C@H](CNCC(O)=O)[C@H]1CC[C@H]2C3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |t:14|
BDBM50195638 C[C@@H]([C@H]1CC[C@H]2C3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)C(=O)NCCCC(O)=O |t:8|
BDBM50195639 C[C@H](CNCCCCCCCC(O)=O)[C@H]1CC[C@H]2C3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OC(C)=O |t:20|
BDBM50195640 C[C@H](CNCCCCC(O)=O)[C@H]1CC[C@H]2C3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |t:17|
BDBM50195641 C[C@H](CNCCCCCCCC(O)=O)[C@H]1CC[C@H]2C3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |t:20|
BDBM50195642 COC(=O)CCCNC[C@@H](C)[C@H]1CC[C@H]2C3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OC(C)=O |t:17|
BDBM50195643 C[C@H](CNCCCC(O)=O)[C@H]1CC[C@H]2C3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OC(C)=O |t:16|
BDBM50195644 COC(=O)[C@@H](N)CCCCNC(=O)[C@@H](C)[C@H]1CC[C@H]2C3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |t:21|
BDBM50195645 C[C@@H]([C@H]1CC[C@H]2C3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)C(=O)NCCCCCCCC(O)=O |t:8|
BDBM50195646 C[C@@H]([C@H]1CC[C@H]2C3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)C(=O)NCCCCC(O)=O |t:8|
BDBM50195647 C[C@@H]([C@H]1CC[C@H]2C3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)C(=O)NCCCC[C@H](NC(=O)OCc1ccccc1)C(O)=O |t:8|
BDBM50195648 C[C@H](CNCCCCCCC(O)=O)[C@H]1CC[C@H]2C3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |t:19|
BDBM50195649 C[C@H](CNCCCCCC(O)=O)[C@H]1CC[C@H]2C3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |t:18|
BDBM50195650 C[C@@H]([C@H]1CC[C@H]2C3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OC(C)=O)C(=O)NC[C@H](NC(=O)OC(C)(C)C)C(O)=O |t:8|
BDBM50195651 C[C@H](CNCCCCCC(O)=O)[C@H]1CC[C@H]2C3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OC(C)=O |t:18|
BDBM50195652 C[C@@H]([C@H]1CC[C@H]2C3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)C(=O)NCCC[C@H](NC(=O)OCc1ccccc1)C(O)=O |t:8|
BDBM50195653 C[C@@H]([C@H]1CC[C@H]2C3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)C(=O)NCC(O)=O |t:8|
BDBM50195654 C[C@H](CNCC[C@H](NC(=O)OC(C)(C)C)C(O)=O)[C@H]1CC[C@H]2C3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OC(C)=O |t:24|
BDBM50409741 CC(O)([C@H]1CC[C@H]2[C@@H]3CCC4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)C1CCCCN1
BDBM50409742 CC(C)(C)[Si](C)(C)O[C@H]1CC[C@@]2(C)C(CC[C@H]3[C@@H]4CC[C@H](C(C)(O)C5CCCCN5)[C@@]4(C)CC[C@H]23)C1