BindingDB logo
myBDB logout

18 SMILES Strings for 25-hydroxyvitamin D-1 alpha hydroxylase, mitochondrial

Compound NameSMILES String
BDBM31768 CC(=O)N1CCN(CC1)c1ccc(OC[C@@H]2CO[C@](Cn3ccnc3)(O2)c2ccc(Cl)cc2Cl)cc1 |r|
BDBM50322357 O=C(NCC(c1ccccc1)n1ccnc1)c1ccc(\C=C\c2ccccc2)cc1
BDBM50027682 COc1cc(OC)cc(\C=C\c2cccc3n(CCCn4ccnc4)ccc23)c1
BDBM50023346 Fc1ccc(\C=C\c2ccc(cc2)C(=O)NCC(c2ccccc2)n2ccnc2)cc1
BDBM50023347 COc1ccc(\C=C\c2ccc(cc2)C(=O)NCC(c2ccccc2)n2ccnc2)cc1
BDBM50023348 COc1cc(OC)cc(\C=C\c2ccc(cc2)C(=O)NCC(c2ccccc2)n2ccnc2)c1
BDBM50023350 Fc1ccc(CCc2ccc(cc2)C(=O)NCC(c2ccccc2)n2ccnc2)cc1
BDBM50023352 COc1cc(OC)cc(\C=C\c2ccc(CCC(=O)C(C)(C)C)cc2)c1
BDBM50023355 COc1cc(OC)cc(\C=C\c2ccc(CCC(OC(=O)n3ccnc3)C(C)(C)C)cc2)c1
BDBM50023357 COc1cc(OC)cc(\C=C\c2ccc(CCC(OS(C)(=O)=O)C(C)(C)C)cc2)c1
BDBM50023359 CC(C)(C)C(=O)C(=C\c1ccc(\C=C\c2ccccc2)cc1)\n1ccnc1
BDBM50023360 CC(C)(C)C(=O)C(Cc1ccc(CCc2ccccc2)cc1)n1ccnc1
BDBM50027683 C(Cn1ccnc1)Cn1ccc2c(\C=C\c3ccccc3)cccc12
BDBM50027694 C(CCn1ccc2cc(\C=C\c3ccccc3)ccc12)Cn1ccnc1
BDBM50027702 C(CCn1ccc2c(\C=C\c3ccccc3)cccc12)Cn1ccnc1
BDBM50023349 COc1cc(\C=C\c2ccc(cc2)C(=O)NCC(c2ccccc2)n2ccnc2)cc(OC)c1OC
BDBM50027700 COc1cc(OC)cc(\C=C\c2cccc3n(CCCCn4ccnc4)ccc23)c1
BDBM50027699 C(Cn1ccnc1)Cn1ccc2cc(\C=C\c3ccccc3)ccc12