BindingDB logo
myBDB logout

9 SMILES Strings for 2C-methyl-D-erythritol-2,4-cyclodiphosphate synthase (IspF)

Compound NameSMILES String
BDBM31909 Nc1ccn([C@H]2O[C@@H](CO)[C@H]3OP(O)(=O)O[C@@H]23)c(=O)n1 |r|
BDBM31910 Nc1ccn([C@@H]2O[C@@H]3COP(O)(=O)O[C@H]3[C@H]2O)c(=O)n1 |r|
BDBM31911 NC(=O)CSc1cc(N)nc(N)n1
BDBM31912 Nc1nnc(o1)-c1nonc1N
BDBM31913 Nc1ccn([C@@H]2O[C@H](COP(O)(O)=O)[C@@H](O)[C@@H]2O)c(=O)n1
BDBM31914 Nc1nc(=O)n(cc1F)[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O
BDBM31915 Nc1ccn(C[C@@H](CO)OCP(O)(O)=O)c(=O)n1 |r|
BDBM31916 N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NO |r|
BDBM31907 OC(=O)CCCC(=O)NC1=CC2OCOC2C=C1 |c:17,t:9|