BindingDB logo
myBDB logout

20 SMILES Strings for 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase

Compound NameSMILES String
BDBM50340465 C[C@]12CC[C@H]3[C@@H](CN=C4CC(=O)CC[C@]34C)[C@@H]1CC[C@@H]2C(O)=O |r,t:7|
BDBM50340466 C[C@]12CC[C@H]3[C@@H](CN=C4CC(=O)CC[C@]34C)[C@@H]1CC[C@@H]2C(=O)Nc1ccc(cc1)N1CCOCC1 |r,t:7|
BDBM50340467 CC(C)(C)c1ccc(cc1NC(=O)[C@H]1CC[C@H]2[C@@H]3CN=C4CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C)C(F)(F)F |r,t:20|
BDBM50340468 C[C@]12CC[C@H]3[C@@H](CN=C4CC(=O)CC[C@]34C)[C@@H]1CC[C@@H]2C(=O)Nc1ccccc1C(=O)c1ccccc1 |r,t:7|
BDBM50340469 CC(C)(C)c1ccc(c(NC(=O)[C@H]2CC[C@H]3[C@@H]4CN=C5CC(=O)CC[C@]5(C)[C@H]4CC[C@]23C)c1)C(C)(C)C |r,t:18|
BDBM50340470 C[C@]12CC[C@H]3[C@@H](CN=C4CC(=O)CC[C@]34C)[C@@H]1CC[C@@H]2C1=N[C@@H]([C@H](O1)c1ccccc1)c1ccccc1 |r,t:7,24|
BDBM50340471 CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CN=C4CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |r,t:14|
BDBM50340472 CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3[C@H](C)N=C4CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |r,t:15|
BDBM50340473 CC(C)(C)NC(=O)[C@H]1CC[C@H]2[C@@H]3CN=C4CC(=O)C=C[C@]4(C)[C@H]3CC[C@]12C |r,c:18,t:13|
BDBM50340474 CCN(CC)C(=O)[C@H]1CC[C@H]2[C@@H]3CN=C4C(C)C(=O)CC[C@]4(C)[C@H]3CC[C@]12C |r,t:13|
BDBM50340475 CCN(CC)C(=O)[C@H]1CC[C@H]2[C@@H]3CN(C)C4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |r,t:15|
BDBM50340476 CCC1C(=O)CC[C@]2(C)[C@H]3CC[C@@]4(C)[C@@H](CC[C@@H]4C(=O)N(CC)CC)[C@@H]3CN=C12 |r,t:29|
BDBM50340477 CCCCCCN1C[C@H]2[C@@H]3CC[C@H](C(=O)N(CC)CC)[C@@]3(C)CC[C@@H]2[C@@]2(C)CCC(=O)C=C12 |r,t:33|
BDBM50340478 CCCN1C[C@H]2[C@@H]3CC[C@H](C(=O)N(CC)CC)[C@@]3(C)CC[C@@H]2[C@@]2(C)CCC(=O)C=C12 |r,t:30|
BDBM50340479 CCCCN1C[C@H]2[C@@H]3CC[C@H](C(=O)N(CC)CC)[C@@]3(C)CC[C@@H]2[C@@]2(C)CCC(=O)C=C12 |r,t:31|
BDBM50340480 CCN(CC)C(=O)[C@H]1CC[C@H]2[C@@H]3CN4CCCCC5=C4[C@](C)(CCC5=O)[C@H]3CC[C@]12C |r,c:18|
BDBM50340481 C[C@]12CC[C@H]3[C@@H](CC[C@H]4NC(=O)C=C[C@]34C)[C@@H]1CC[C@@H]2C(=O)Nc1cc(ccc1C(F)(F)F)C(F)(F)F |r,c:12|
BDBM50340482 CC(C)(C)NC(=O)[C@H]1CC[C@H]2[C@@H]3CN=C4CC(=O)C5CC5[C@]4(C)[C@H]3CC[C@]12C |r,t:13|
BDBM50340483 CCN(CC)C(=O)[C@H]1CC[C@H]2[C@@H]3CN=C4CC(=O)C5CC5[C@]4(C)[C@H]3CC[C@]12C |r,t:13|
BDBM50334788 CC(C)(C)NC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4NC(=O)C=C[C@]4(C)[C@H]3CC[C@]12C |r,c:18|