BindingDB logo
myBDB logout

3 SMILES Strings for 3-beta-hydroxysteroid dehydrogenase/delta 5-->4-isomerase type II

Compound NameSMILES String
BDBM50329315 NC(=O)[C@@]12CC3CC(C1)[C@H](OC(=O)N1CC[C@H](C1)Nc1ncccc1C#N)C(C3)C2 |r,wU:16.19,9.10,wD:3.2,TLB:6:5:29:8.7.9,6:7:4.5.28:29,THB:9:7:4:28.27.29,9:27:4:8.6.7,10:9:4.5.28:29,(3.85,-46.65,;5.2,-45.88,;5.2,-44.34,;6.53,-46.66,;5.34,-47.93,;6.84,-47.51,;8.24,-48.08,;9.26,-46.8,;7.86,-47.15,;9.27,-45.27,;10.61,-44.52,;11.94,-45.3,;11.92,-46.84,;13.28,-44.54,;13.3,-43,;14.78,-42.54,;15.66,-43.8,;14.74,-45.03,;17.2,-43.83,;17.99,-42.51,;17.24,-41.17,;18.03,-39.85,;19.58,-39.87,;20.32,-41.22,;19.53,-42.54,;20.28,-43.88,;21.03,-45.23,;7.87,-44.69,;6.83,-45.93,;6.53,-45.17,)|
BDBM50329316 NC(=O)[C@@]12CC3CC(C1)[C@H](OC(=O)N1CC[C@H](C1)Nc1ccc(cn1)C#N)C(C3)C2 |r,wU:16.19,9.10,wD:3.2,TLB:6:5:29:8.7.9,6:7:4.5.28:29,THB:9:7:4:28.27.29,9:27:4:8.6.7,10:9:4.5.28:29,(23.78,-45.32,;25.12,-44.54,;25.13,-43,;26.46,-45.32,;25.26,-46.6,;26.77,-46.18,;28.17,-46.74,;29.18,-45.46,;27.79,-45.81,;29.2,-43.94,;30.54,-43.18,;31.86,-43.96,;31.85,-45.5,;33.2,-43.2,;33.23,-41.66,;34.7,-41.21,;35.59,-42.47,;34.66,-43.7,;37.13,-42.49,;37.92,-41.17,;39.46,-41.2,;40.25,-39.88,;39.5,-38.54,;37.95,-38.51,;37.17,-39.84,;40.29,-37.21,;41.08,-35.89,;27.8,-43.36,;26.76,-44.59,;26.45,-43.84,)|
BDBM50353386 C[C@H](N1CC[C@@](CCO)(OC1=O)c1ccc(F)cc1)c1ccc(cc1)-c1ccc(F)cc1F |r|