BindingDB logo
myBDB logout

10 SMILES Strings for 3-dehydroquinate synthase

Compound NameSMILES String
BDBM26188 Oc1ccccc1O
BDBM93205 OC1CC(OC(CP([O-])([O-])=O)C1O)C([O-])=O
BDBM93206 OC1CC(O)(OC(CP([O-])([O-])=O)C1O)C([O-])=O
BDBM50028881 O[C@H]1CC[C@@](O)(C[C@@H]1CP(O)(O)=O)C(O)=O
BDBM50028883 O[C@H]1C[C@@H](CP(O)(O)=O)C[C@](O)(C1)C(O)=O
BDBM50100859 Oc1cccc(CCP(O)(O)=O)c1O
BDBM50100860 OC(=O)c1cc(O)c(O)c(CP(O)(O)=O)c1
BDBM50100861 OC(=O)c1ccc(O)c(O)c1
BDBM50100862 OC(=O)c1cc(O)c(O)c(CCP(O)(O)=O)c1
BDBM50280172 OC1CC(O)(CC(CP(O)(O)=O)C1O)C(O)=O