BindingDB logo
myBDB logout

3 SMILES Strings for 3-deoxy-D-arabino-heptulosonate 7-phosphate synthase, Phe-sensitive

Compound NameSMILES String
BDBM50350723 CC(=CP(O)(O)=O)C(O)=O |w:2.2|
BDBM50350725 OC(=O)C(CP(O)(O)=O)=CCCCCOP(O)(O)=O |w:9.9|
BDBM50350727 OC(=O)C(CCCCCBr)=CP(O)(O)=O |w:10.10|