BindingDB logo
myBDB logout

1 SMILES String for 3-hydroxyanthranilate 3,4-dioxygenase

Compound NameSMILES String
BDBM50446510 Cc1ccc(C(O)=O)c(N)[n+]1[O-]