BindingDB logo
myBDB logout

3 SMILES Strings for 3-keto-steroid reductase

Compound NameSMILES String
BDBM50311131 CN1[C@@H]2CC[C@H]3[C@@H]4CC[C@@]5(CCC(C)(C)C(=O)O5)[C@@]4(C)CC[C@@H]3[C@@]2(C)CCC1=O |r|
BDBM50311132 CCCCCCCCCCN(C=O)C1CC[C@H]2[C@@H]3CC[C@H]4N(C)C(=O)CC[C@]4(C)[C@H]3CC[C@]12C |r|
BDBM50311133 CCCCCCCN(C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4N(C)C(=O)CC[C@]4(C)[C@H]3CC[C@]12C |r|