BindingDB logo
myBDB logout

10 SMILES Strings for 3-oxoacyl-(Acyl-carrier protein) reductase

Compound NameSMILES String
BDBM50070942 Oc1cc(O)c2C[C@@H](OC(=O)c3cc(O)c(O)c(O)c3)[C@H](Oc2c1)c1cc(O)c(O)c(O)c1 |r|
BDBM50440624 Oc1cc(Cl)ccc1Oc1cc2ccccc2oc1=O
BDBM50440619 Cc1c(Oc2ccc(Cl)cc2O)c(=O)oc2cc(O)ccc12
BDBM50440620 Oc1ccc2cc(Oc3ccc(Cl)cc3O)c(=O)oc2c1
BDBM50440621 Cc1c(Oc2ccc(Cl)cc2O)c(=O)oc2ccccc12
BDBM50440622 Oc1ccc2cc(-c3ccc(Oc4ccc(Cl)cc4O)cc3)c(=O)oc2c1
BDBM50440623 Oc1ccc2oc(=O)c(Oc3ccc(Cl)cc3O)cc2c1
BDBM50440625 CCc1cc(=O)oc2cc(Oc3ccc(Cl)cc3O)ccc12
BDBM50440626 Cc1cc(=O)oc2cc(Oc3ccc(Cl)cc3O)ccc12
BDBM50440627 Oc1cc(O)c2cc(Oc3ccc(Cl)cc3O)c(=O)oc2c1