BindingDB logo
myBDB logout

40 SMILES Strings for 3-oxoacyl-[acyl-carrier-protein] synthase 1

Compound NameSMILES String
BDBM50134358 CC1C(=O)SC(C)(Cc2ccc(C)cc2)C1=O
BDBM50134359 COc1ccc(CC2(C)SC(=O)C(C)C2=O)cc1
BDBM50134346 COc1cccc(CC2(C)SC(=O)C(C)C2=O)c1
BDBM50134355 CC1C(=O)SC(C)(Cc2ccc(cc2)C(C)(C)C)C1=O
BDBM50138281 CC1C(=O)SC(C)(\C=C(/C)C=C)C1=O
BDBM50180123 CC(C)CCC1(C)SC(=O)C(C)C1=O
BDBM50180124 COc1ccccc1CC1(C)SC(=O)C(C)C1=O
BDBM50180125 CC1C(=O)SC(C)(Cc2ccccc2C)C1=O
BDBM50180127 CCCCCCCCCCCCCCC1(C)SC(=O)C(C)C1=O
BDBM50180128 CC1C(=O)SC(C)(\C=C\C=C)C1=O
BDBM50180122 CCCCCCCCCCC(C)C1(C)SC(=O)C(C)C1=O
BDBM50180129 CCCCCCCCC(C)C1(C)SC(=O)C(C)C1=O
BDBM50180130 CCCCCCCCCCCCCC1(C)SC(=O)C(C)C1=O
BDBM50180131 CC1C(=O)SC(C)(Cc2cccc(Cl)c2)C1=O
BDBM50180133 CC1C(=O)SC(C)(CC2CCC2)C1=O
BDBM50180135 C\C=C\C(\C)=C\[C@@]1(C)SC(=O)C(C)C1=O
BDBM50180137 CC1C(=O)SC(C)(CCCCCCC=C)C1=O
BDBM50180139 CC(c1ccccc1)C1(C)SC(=O)C(C)C1=O
BDBM50180099 CC1C(=O)SC(C)(Cc2cccc(c2)C(F)(F)F)C1=O
BDBM50180100 CC1C(=O)SC(C)(CCc2ccccc2)C1=O
BDBM50180101 COc1cc(CC2(C)SC(=O)C(C)C2=O)cc(OC)c1
BDBM50180102 CC1C(=O)SC(C)(Cc2ccccc2Cl)C1=O
BDBM50180103 CCCCCCCC1(C)SC(=O)C(C)C1=O
BDBM50180104 CCCCCCCCCCCC1(C)SC(=O)C(C)C1=O
BDBM50180105 CC1C(=O)SC(C)(Cc2ccc3ccccc3c2)C1=O
BDBM50180106 CC1C(=O)SC(C)(Cc2c(Cl)cccc2Cl)C1=O
BDBM50180107 CC1C(=O)SC(C)(Cc2c(C)cc(C)cc2C)C1=O
BDBM50180108 CC1C(=O)SC(C)(Cc2ccc(Cl)cc2)C1=O
BDBM50180109 CC1C(=O)SC(C)(CCC=C)C1=O
BDBM50180110 CCCCCC(C)C1(C)SC(=O)C(C)C1=O
BDBM50180112 CC1C(=O)SC(C)(Cc2cc(C)ccc2C)C1=O
BDBM50180113 CC1C(=O)SC(C)(CCCc2ccccc2)C1=O
BDBM50180115 CC1C(=O)SC(C)(Cc2ccc(cc2)[N+]([O-])=O)C1=O
BDBM50180116 CCCCCCCCCC1(C)SC(=O)C(C)C1=O
BDBM50180117 CC1C(=O)SC(C)(Cc2cccc(C)c2)C1=O
BDBM50180118 CC\C=C\CC1(C)SC(=O)C(C)C1=O
BDBM50180119 CC1C(=O)SC(C)(CC2CCCCC2)C1=O
BDBM50180120 CC1C(=O)SC(C)(Cc2ccc(F)cc2)C1=O
BDBM50180121 CCCCC(CC)CC1(C)SC(=O)C(C)C1=O
BDBM50241313 CC1C(=O)S[C@](C)(\C=C(/C)C=C)C1=O |r|