BindingDB logo
myBDB logout

6 SMILES Strings for 3-phosphoinositide-dependent protein kinase 1 (PDK1)

Compound NameSMILES String
BDBM223486 CC1=NN(C(=O)c2ccccc2)C(=O)C1\N=N\c1ccc(cc1)S(=O)(=O)Nc1ncccn1 |t:1|
BDBM223477 CC1=NN(C(=O)c2ccc(Cl)cc2)C(=O)C1\N=N\c1ccc(cc1)S(=O)(=O)Nc1ncccn1 |t:1|
BDBM223487 CC1=NN(C(=O)c2ccc(N)cc2)C(=O)C1\N=N\c1ccc(cc1)S(=O)(=O)Nc1ncccn1 |t:1|
BDBM223488 CC1=NN(C(=O)c2ccc(cc2)C(C)(C)C)C(=O)C1\N=N\c1ccc(cc1)S(=O)(=O)Nc1ncccn1 |t:1|
BDBM223489 CC1=NN(C(=O)c2ccc(O)cc2)C(=O)C1\N=N\c1ccc(cc1)S(=O)(=O)Nc1ncccn1 |t:1|
BDBM223490 CC1=NN(C(O)C1\N=N\c1ccc(cc1)S(=O)(=O)Nc1ncccn1)C(=O)c1ccc(Cl)cc1 |t:1|