BindingDB logo
myBDB logout

6 SMILES Strings for 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase

Compound NameSMILES String
BDBM50283498 O=C1ON=C(\C1=C\c1ccco1)c1ccccc1 |c:3|
BDBM50355113 CC1NC(=O)C(C#N)=C(SCc2ccccc2)S1 |t:7|
BDBM50355114 Cc1ccc(\C=C2/C(=O)ON=C2c2ccccc2)o1 |c:10|
BDBM50355115 Clc1ccc(cc1)-c1ccc(C=c2c(=C)[nH]oc2=O)o1 |w:11.11|
BDBM50355116 Oc1ccccc1C1NC(=O)C(C#N)=C(SCc2ccccc2)S1 |t:14|
BDBM50355117 C=c1[nH]oc(=O)c1=Cc1ccc(o1)-c1ccccc1 |w:7.8|