BindingDB logo
myBDB logout

5 SMILES Strings for 4-hydroxy-2-oxoglutarate aldolase, mitochondrial

Compound NameSMILES String
BDBM26116 OC(=O)c1cccc(n1)C(O)=O
BDBM50160721 OC(=O)CCCCC(=O)C(O)=O
BDBM50229870 OC(=O)c1cc(O)cc(n1)C(O)=O
BDBM50411596 OC(=O)C(=O)c1cccc(c1)C(=O)C(O)=O
BDBM50411597 COC(=O)C(N=O)c1cccc(c1)C(N=O)C(=O)OC