BindingDB logo
myBDB logout

1 SMILES String for 5-HT1 like

Compound NameSMILES String
BDBM82472 CC(N)Cc1c[nH]c2ccc(OCc3cccs3)cc12