BindingDB logo
myBDB logout

5 SMILES Strings for 5-HT1A/ 5-HT2c

Compound NameSMILES String
BDBM50024573 Cn1c(=O)cnn(CCCCN2CCN(CC2)c2cccc(Br)n2)c1=O
BDBM50024603 Cn1c(=O)cnn(CCCCN2CCN(CC2)c2ccc(I)cc2)c1=O
BDBM50024605 Cn1c(=O)cnn(CCCCN2CCN(CC2)c2ccccc2)c1=O
BDBM210829 Cn1c(=O)cnn(CCCCN2CCN(CC2)c2cccc(I)n2)c1=O
BDBM210830 Cn1c(=O)cnn(CCCCN2CCN(CC2)c2ccccc2Br)c1=O