BindingDB logo
myBDB logout

36 SMILES Strings for 5-Lipoxygenase

Compound NameSMILES String
BDBM4375 OC(=O)\C=C\c1ccc(O)c(O)c1
BDBM22344 CS(=O)(=O)c1ccc(cc1)C#CC(=O)c1ccccc1
BDBM22366 CS(=O)(=O)c1ccc(cc1)C#CC(=O)c1ccno1
BDBM22367 CS(=O)(=O)c1ccc(cc1)C#CC(=O)c1ccc(cc1)[N+]([O-])=O
BDBM22368 CS(=O)(=O)c1ccc(cc1)C#CC(=O)c1cccc(c1)[N+]([O-])=O
BDBM22370 CSc1ccc(cc1)C(=O)C#Cc1ccc(cc1)S(C)(=O)=O
BDBM22371 CS(=O)(=O)c1ccc(cc1)C#CC(=O)c1ccc(cc1)S(C)(=O)=O
BDBM22372 C[C@@H](Cc1ccc(O)c(O)c1)[C@H](C)Cc1ccc(O)c(O)c1
BDBM22334 CC(=O)N(O)C\C=C\c1cccc(Oc2ccccc2)c1
BDBM22345 Cc1ccc(cc1)C(=O)C#Cc1ccc(cc1)S(C)(=O)=O
BDBM22346 CCCc1ccc(cc1)C(=O)C#Cc1ccc(cc1)S(C)(=O)=O
BDBM22347 CCCCc1ccc(cc1)C(=O)C#Cc1ccc(cc1)S(C)(=O)=O
BDBM22348 CC(C)c1ccc(cc1)C(=O)C#Cc1ccc(cc1)S(C)(=O)=O
BDBM22349 CS(=O)(=O)c1ccc(cc1)C#CC(=O)c1ccc(cc1)C(F)(F)F
BDBM22350 CS(=O)(=O)c1ccc(cc1)C#CC(=O)c1ccc(cc1)C#N
BDBM22351 CS(=O)(=O)c1ccc(cc1)C#CC(=O)c1ccc(F)cc1
BDBM22352 CS(=O)(=O)c1ccc(cc1)C#CC(=O)c1ccc(F)c(F)c1
BDBM22353 COc1ccc(cc1)C(=O)C#Cc1ccc(cc1)S(C)(=O)=O
BDBM22354 CS(=O)(=O)c1ccc(cc1)C#CC(=O)c1ccc(O)cc1
BDBM22355 COc1cccc(c1)C(=O)C#Cc1ccc(cc1)S(C)(=O)=O
BDBM22356 CS(=O)(=O)c1ccc(cc1)C#CC(=O)c1cccc(O)c1
BDBM22357 COc1ccc(cc1OC)C(=O)C#Cc1ccc(cc1)S(C)(=O)=O
BDBM22358 COc1cc(cc(OC)c1OC)C(=O)C#Cc1ccc(cc1)S(C)(=O)=O
BDBM22359 COC(=O)c1ccc(cc1)C(=O)C#Cc1ccc(cc1)S(C)(=O)=O
BDBM22361 CS(=O)(=O)c1ccc(cc1)C#CC(=O)c1ccoc1
BDBM22362 CS(=O)(=O)c1ccc(cc1)C#CC(=O)c1cccc2ccccc12
BDBM22363 COc1ccc(C(=O)C#Cc2ccc(cc2)S(C)(=O)=O)c2ccccc12
BDBM22364 COc1cc(ccc1O)C(=O)C#Cc1ccc(cc1)S(C)(=O)=O
BDBM22365 COc1ccc(cc1O)C(=O)C#Cc1ccc(cc1)S(C)(=O)=O
BDBM50303169 CC(=O)NS(=O)(=O)c1ccc(cc1C(O)=O)-c1ccn(C(F)F)c(=O)c1
BDBM50303170 CC(=O)NS(=O)(=O)c1cc(ccc1C(O)=O)-c1ccn(C(F)F)c(=O)c1
BDBM50303171 OC(=O)c1ccc(cc1O)-c1ccn(C(F)F)c(=O)c1
BDBM50303172 OC(=O)c1cc(ccc1O)-c1ccn(C(F)F)c(=O)c1
BDBM50328678 ONC(=O)CCCCCN1C(=O)c2cccc3cccc(C1=O)c23
BDBM218835 CC(=O)N(O)CCCCCN1C(=O)c2cccc3cccc(C1=O)c23
BDBM218836 CC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCN1C(=O)c2cccc3cccc(C1=O)c23