BindingDB logo
myBDB logout

20 SMILES Strings for 5-Lipoxygenase/5-lipoxygenase activating protein

Compound NameSMILES String
BDBM50006805 CC(C)c1ccc2n(Cc3ccc(Cl)cc3)c(CC(C)(C)C(O)=O)c(SC(C)(C)C)c2c1
BDBM50029559 CC(C)(C)Sc1c(CC(C)(C)C(O)=O)n(Cc2ccc(Cl)cc2)c2ccc(OCc3ccc4ccccc4n3)cc12
BDBM50080234 CC(C)(C)Sc1c(CC(C)(C)C(O)=O)n(Cc2ccc(Cl)cc2)c2ccc(OCc3cccnc3)cc12
BDBM50080250 CC(C)(C)Sc1c(CC(C)(C)C(O)=O)n(Cc2ccc(Cl)cc2)c2ccc(OCc3ccccn3)cc12
BDBM50080252 CC(C)(C)Sc1c(CC(C)(C)C(O)=O)n(Cc2ccc(Cl)cc2)c2ccc(OCc3ccncc3)cc12
BDBM50080255 CC(C)(C)Sc1c(CC(C)(C)C(O)=O)n(Cc2ccc(Cl)cc2)c2ccc(OCc3nc4ccccc4s3)cc12
BDBM50080256 CC(C)(C)Sc1c(CC(C)(C)C(O)=O)n(Cc2ccc(Cl)cc2)c2ccc(OCc3cccc(Cl)n3)cc12
BDBM50080258 CC(C)(C)Sc1c(CC(C)(C)C(O)=O)n(Cc2ccc(Cl)cc2)c2ccc(OCc3cscn3)cc12
BDBM50287318 CC(C)(C)Sc1c(CC(C)(C)C(O)=O)n(Cc2ccc(Cl)cc2)c2ccc(OCc3nccs3)cc12
BDBM50287319 CC(C)(C)Sc1c(CC(C)(C)\C=N\OCC(O)=O)n(Cc2ccc(Cl)cc2)c2ccc(OCc3cccc(Cl)n3)cc12
BDBM50287321 CC(C)c1ccc2n(Cc3ccc(Cl)cc3)c(CC(C)(C)CNC(N)=O)c(SC(C)(C)C)c2c1
BDBM50287322 CC(C)c1ccc2n(Cc3ccc(Cl)cc3)c(CC(C)(C)CN(O)C(N)=O)c(SC(C)(C)C)c2c1
BDBM50287323 CC(C)c1ccc2n(Cc3ccc(Cl)cc3)c(CC(C)(C)NC(=O)N(C)O)c(SC(C)(C)C)c2c1
BDBM50287325 CC(C)(C)Sc1c(CC(C)(C)\C=N\OCC(O)=O)n(Cc2ccc(Cl)cc2)c2ccc(OCc3ccc4ccccc4n3)cc12
BDBM50287326 CC(C)(C)Sc1c(CC(C)(C)C(O)=O)n(Cc2ccc(Cl)cc2)c2ccc(OCc3ccc4ccccc4c3)cc12
BDBM50287327 CC(C)(C)Sc1c(CC(C)(C)\C=N\OCC(O)=O)n(Cc2ccc(Cl)cc2)c2ccc(OCc3cscn3)cc12
BDBM50287328 CC(C)(C)Sc1c(CC(C)(C)\C=N\OCC(O)=O)n(Cc2ccc(Cl)cc2)c2ccc(OCc3ccccn3)cc12
BDBM50287317 CC(C)c1ccc2n(Cc3ccc(Cl)cc3)c(CC(C)(C)\C=N\OCC(O)=O)c(SC(C)(C)C)c2c1
BDBM50287324 CO\N=C\C(C)(C)Cc1c(SC(C)(C)C)c2cc(ccc2n1Cc1ccc(Cl)cc1)C(C)C
BDBM50213868 CC(C)c1ccc2n(Cc3ccc(Cl)cc3)c(CC(C)(C)\C=N\O)c(SC(C)(C)C)c2c1